C10H14O2S — CID 101190092
(3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]thiophene 2,2-dioxide (PubChem CID 101190092) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]thiophene 2,2-dioxide.
| Compound Name | (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]thiophene 2,2-dioxide |
|---|---|
| PubChem CID | 101190092 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (3aE,6Z)-1,3,5,8,9,9a-hexahydrocycloocta[c]thiophene 2,2-dioxide |
| SMILES | O=S1(=O)C/C2=C/C/C=C\CCC2C1 |
| InChI | InChI=1S/C10H14O2S/c11-13(12)7-9-5-3-1-2-4-6-10(9)8-13/h1-2,5,10H,3-4,6-8H2/b2-1-,9-5- |
| InChIKey | OISHOYDTPGURFW-HBRSPCJUSA-N |
| XLogP | 1.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|