C8H12O2S — CID 15940007
(1S,3S,4R)-3-ethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide (PubChem CID 15940007) has the molecular formula C8H12O2S and a molecular weight of 172.25 g/mol. Its IUPAC name is (1S,3S,4R)-3-ethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide.
| Compound Name | (1S,3S,4R)-3-ethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide |
|---|---|
| PubChem CID | 15940007 |
| Molecular Formula | C8H12O2S |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.06 |
| IUPAC Name | (1S,3S,4R)-3-ethyl-2lambda6-thiabicyclo[2.2.1]hept-5-ene 2,2-dioxide |
| SMILES | CC[C@H]1[C@H]2C=C[C@H](C2)S1(=O)=O |
| InChI | InChI=1S/C8H12O2S/c1-2-8-6-3-4-7(5-6)11(8,9)10/h3-4,6-8H,2,5H2,1H3/t6-,7+,8-/m0/s1 |
| InChIKey | HQFLKKVLICCMAE-RNJXMRFFSA-N |
| XLogP | 1.14 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|