C17H26N2O3 — CID 101192207
1,3-dicyclohexyl-1,3-diazepane-2,4,7-trione (PubChem CID 101192207) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is 1,3-dicyclohexyl-1,3-diazepane-2,4,7-trione.
| Compound Name | 1,3-dicyclohexyl-1,3-diazepane-2,4,7-trione |
|---|---|
| PubChem CID | 101192207 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | 1,3-dicyclohexyl-1,3-diazepane-2,4,7-trione |
| SMILES | O=C1CCC(=O)N(C2CCCCC2)C(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C17H26N2O3/c20-15-11-12-16(21)19(14-9-5-2-6-10-14)17(22)18(15)13-7-3-1-4-8-13/h13-14H,1-12H2 |
| InChIKey | GUISEMPSOZDOBS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |