C17H21F3N2O3 — CID 101192443
2-acetamido-3-methyl-N-(4,4,4-trifluoro-3-oxo-2-phenylbutyl)butanamide (PubChem CID 101192443) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is 2-acetamido-3-methyl-N-(4,4,4-trifluoro-3-oxo-2-phenylbutyl)butanamide.
| Compound Name | 2-acetamido-3-methyl-N-(4,4,4-trifluoro-3-oxo-2-phenylbutyl)butanamide |
|---|---|
| PubChem CID | 101192443 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-acetamido-3-methyl-N-(4,4,4-trifluoro-3-oxo-2-phenylbutyl)butanamide |
| SMILES | CC(=O)NC(C(=O)NCC(C(=O)C(F)(F)F)c1ccccc1)C(C)C |
| InChI | InChI=1S/C17H21F3N2O3/c1-10(2)14(22-11(3)23)16(25)21-9-13(15(24)17(18,19)20)12-7-5-4-6-8-12/h4-8,10,13-14H,9H2,1-3H3,(H,21,25)(H,22,23) |
| InChIKey | RZFGDFREBQYVQV-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |