C30H50 — CID 101193647
(1S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,2,3,4,4a,8-hexahydronaphthalene (PubChem CID 101193647) has the molecular formula C30H50 and a molecular weight of 410.73 g/mol. Its IUPAC name is (1S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,2,3,4,4a,8-hexahydronaphthalene.
| Compound Name | (1S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,2,3,4,4a,8-hexahydronaphthalene |
|---|---|
| PubChem CID | 101193647 |
| Molecular Formula | C30H50 |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.39 |
| IUPAC Name | (1S,4aS,8aR)-2,5,5,8a-tetramethyl-1-[(3E,7E)-4,8,12-trimethyltrideca-3,7,11-trienyl]-1,2,3,4,4a,8-hexahydronaphthalene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC[C@H]1C(C)CC[C@H]2C(C)(C)C=CC[C@]12C |
| InChI | InChI=1S/C30H50/c1-23(2)13-9-14-24(3)15-10-16-25(4)17-11-18-27-26(5)19-20-28-29(6,7)21-12-22-30(27,28)8/h12-13,15,17,21,26-28H,9-11,14,16,18-20,22H2,1-8H3/b24-15+,25-17+/t26?,27-,28-,30+/m0/s1 |
| InChIKey | GFJYEVCOQXGBQU-RLSBUOHESA-N |
| XLogP | 9.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|