C21H16BrF5N2O4 — CID 10119454
4-(2-bromo-3,5-difluorophenyl)-2-hydroxy-4-methyl-N-(1-oxo-2,3-benzoxazin-6-yl)-2-(trifluoromethyl)pentanamide (PubChem CID 10119454) has the molecular formula C21H16BrF5N2O4 and a molecular weight of 535.26 g/mol. Its IUPAC name is 4-(2-bromo-3,5-difluorophenyl)-2-hydroxy-4-methyl-N-(1-oxo-2,3-benzoxazin-6-yl)-2-(trifluoromethyl)pentanamide.
| Compound Name | 4-(2-bromo-3,5-difluorophenyl)-2-hydroxy-4-methyl-N-(1-oxo-2,3-benzoxazin-6-yl)-2-(trifluoromethyl)pentanamide |
|---|---|
| PubChem CID | 10119454 |
| Molecular Formula | C21H16BrF5N2O4 |
| Molecular Weight | 535.26 g/mol |
| Exact Mass | 534.02 |
| IUPAC Name | 4-(2-bromo-3,5-difluorophenyl)-2-hydroxy-4-methyl-N-(1-oxo-2,3-benzoxazin-6-yl)-2-(trifluoromethyl)pentanamide |
| SMILES | CC(C)(CC(O)(C(=O)Nc1ccc2c(=O)oncc2c1)C(F)(F)F)c1cc(F)cc(F)c1Br |
| InChI | InChI=1S/C21H16BrF5N2O4/c1-19(2,14-6-11(23)7-15(24)16(14)22)9-20(32,21(25,26)27)18(31)29-12-3-4-13-10(5-12)8-28-33-17(13)30/h3-8,32H,9H2,1-2H3,(H,29,31) |
| InChIKey | QTISPLYEQUKHFP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.26 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|