C23H18F6N2O4 — CID 10185369
3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-[[1-(2,3,5-trifluorophenyl)cyclobutyl]methyl]propanamide (PubChem CID 10185369) has the molecular formula C23H18F6N2O4 and a molecular weight of 500.40 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-[[1-(2,3,5-trifluorophenyl)cyclobutyl]methyl]propanamide.
| Compound Name | 3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-[[1-(2,3,5-trifluorophenyl)cyclobutyl]methyl]propanamide |
|---|---|
| PubChem CID | 10185369 |
| Molecular Formula | C23H18F6N2O4 |
| Molecular Weight | 500.40 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)-2-[[1-(2,3,5-trifluorophenyl)cyclobutyl]methyl]propanamide |
| SMILES | Cc1noc(=O)c2ccc(NC(=O)C(O)(CC3(c4cc(F)cc(F)c4F)CCC3)C(F)(F)F)cc12 |
| InChI | InChI=1S/C23H18F6N2O4/c1-11-15-9-13(3-4-14(15)19(32)35-31-11)30-20(33)22(34,23(27,28)29)10-21(5-2-6-21)16-7-12(24)8-17(25)18(16)26/h3-4,7-9,34H,2,5-6,10H2,1H3,(H,30,33) |
| InChIKey | LEVWUZJIDRRVGC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|