C23H20ClF3N2O4 — CID 10457897
2-[(5-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide (PubChem CID 10457897) has the molecular formula C23H20ClF3N2O4 and a molecular weight of 480.87 g/mol. Its IUPAC name is 2-[(5-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide.
| Compound Name | 2-[(5-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide |
|---|---|
| PubChem CID | 10457897 |
| Molecular Formula | C23H20ClF3N2O4 |
| Molecular Weight | 480.87 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 2-[(5-chloro-1,2,3,4-tetrahydronaphthalen-1-yl)methyl]-3,3,3-trifluoro-2-hydroxy-N-(4-methyl-1-oxo-2,3-benzoxazin-6-yl)propanamide |
| SMILES | Cc1noc(=O)c2ccc(NC(=O)C(O)(CC3CCCc4c(Cl)cccc43)C(F)(F)F)cc12 |
| InChI | InChI=1S/C23H20ClF3N2O4/c1-12-18-10-14(8-9-17(18)20(30)33-29-12)28-21(31)22(32,23(25,26)27)11-13-4-2-6-16-15(13)5-3-7-19(16)24/h3,5,7-10,13,32H,2,4,6,11H2,1H3,(H,28,31) |
| InChIKey | AFAYAMYPKWRICU-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |