C20H16Cl2N4O6 — CID 101197324
N-[(3S,3aR,6S,6aR)-6-[(2-chloro-6-nitrophenyl)methylideneamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-(2-chloro-6-nitrophenyl)methanimine (PubChem CID 101197324) has the molecular formula C20H16Cl2N4O6 and a molecular weight of 479.28 g/mol. Its IUPAC name is N-[(3S,3aR,6S,6aR)-6-[(2-chloro-6-nitrophenyl)methylideneamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-(2-chloro-6-nitrophenyl)methanimine.
| Compound Name | N-[(3S,3aR,6S,6aR)-6-[(2-chloro-6-nitrophenyl)methylideneamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-(2-chloro-6-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 101197324 |
| Molecular Formula | C20H16Cl2N4O6 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | N-[(3S,3aR,6S,6aR)-6-[(2-chloro-6-nitrophenyl)methylideneamino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]-1-(2-chloro-6-nitrophenyl)methanimine |
| SMILES | O=[N+]([O-])c1cccc(Cl)c1/C=N/[C@H]1CO[C@H]2[C@@H]1OC[C@@H]2/N=C/c1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16Cl2N4O6/c21-13-3-1-5-17(25(27)28)11(13)7-23-15-9-31-20-16(10-32-19(15)20)24-8-12-14(22)4-2-6-18(12)26(29)30/h1-8,15-16,19-20H,9-10H2/b23-7+,24-8+/t15-,16-,19+,20+/m0/s1 |
| InChIKey | AKDMWSYTNQQJTO-QEVXJYSTSA-N |
| XLogP | 3.88 |
| TPSA | 129.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|