C56H55NO5 — CID 101197802
5-(4-aminophenyl)-12,20-bis(3,5-ditert-butylphenoxy)-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione (PubChem CID 101197802) has the molecular formula C56H55NO5 and a molecular weight of 822.06 g/mol. Its IUPAC name is 5-(4-aminophenyl)-12,20-bis(3,5-ditert-butylphenoxy)-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione.
| Compound Name | 5-(4-aminophenyl)-12,20-bis(3,5-ditert-butylphenoxy)-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
|---|---|
| PubChem CID | 101197802 |
| Molecular Formula | C56H55NO5 |
| Molecular Weight | 822.06 g/mol |
| Exact Mass | 821.41 |
| IUPAC Name | 5-(4-aminophenyl)-12,20-bis(3,5-ditert-butylphenoxy)-16-oxahexacyclo[12.6.2.12,6.011,21.018,22.010,23]tricosa-1(20),2(23),3,5,7,9,11,13,18,21-decaene-15,17-dione |
| SMILES | CC(C)(C)c1cc(Oc2cc3c4c(cc(Oc5cc(C(C)(C)C)cc(C(C)(C)C)c5)c5c6ccc(-c7ccc(N)cc7)c7cccc(c2c45)c76)C(=O)OC3=O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C56H55NO5/c1-53(2,3)31-22-32(54(4,5)6)25-36(24-31)60-44-28-42-47-43(52(59)62-51(42)58)29-45(61-37-26-33(55(7,8)9)23-34(27-37)56(10,11)12)49-41-21-20-38(30-16-18-35(57)19-17-30)39-14-13-15-40(46(39)41)48(44)50(47)49/h13-29H,57H2,1-12H3 |
| InChIKey | SGDHRDHNPXPHGI-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.06 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|