C18H28O4 — CID 101198584
diethyl 2-[(E)-3-methylhept-2-enyl]-2-prop-2-ynylpropanedioate (PubChem CID 101198584) has the molecular formula C18H28O4 and a molecular weight of 308.42 g/mol. Its IUPAC name is diethyl 2-[(E)-3-methylhept-2-enyl]-2-prop-2-ynylpropanedioate.
| Compound Name | diethyl 2-[(E)-3-methylhept-2-enyl]-2-prop-2-ynylpropanedioate |
|---|---|
| PubChem CID | 101198584 |
| Molecular Formula | C18H28O4 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | diethyl 2-[(E)-3-methylhept-2-enyl]-2-prop-2-ynylpropanedioate |
| SMILES | C#CCC(C/C=C(\C)CCCC)(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H28O4/c1-6-10-11-15(5)12-14-18(13-7-2,16(19)21-8-3)17(20)22-9-4/h2,12H,6,8-11,13-14H2,1,3-5H3/b15-12+ |
| InChIKey | JNPDFGZVEYHZDF-NTCAYCPXSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|