C21H30N4O3 — CID 101199230
methyl (3R)-3-[[(3S)-3-azido-5-phenylpentanoyl]amino]-3-cyclohexylpropanoate (PubChem CID 101199230) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is methyl (3R)-3-[[(3S)-3-azido-5-phenylpentanoyl]amino]-3-cyclohexylpropanoate.
| Compound Name | methyl (3R)-3-[[(3S)-3-azido-5-phenylpentanoyl]amino]-3-cyclohexylpropanoate |
|---|---|
| PubChem CID | 101199230 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | methyl (3R)-3-[[(3S)-3-azido-5-phenylpentanoyl]amino]-3-cyclohexylpropanoate |
| SMILES | COC(=O)C[C@@H](NC(=O)C[C@H](CCc1ccccc1)N=[N+]=[N-])C1CCCCC1 |
| InChI | InChI=1S/C21H30N4O3/c1-28-21(27)15-19(17-10-6-3-7-11-17)23-20(26)14-18(24-25-22)13-12-16-8-4-2-5-9-16/h2,4-5,8-9,17-19H,3,6-7,10-15H2,1H3,(H,23,26)/t18-,19+/m0/s1 |
| InChIKey | MLUJBIWPHFYMAB-RBUKOAKNSA-N |
| XLogP | 4.32 |
| TPSA | 104.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|