C13H20INO2 — CID 101200022
methyl 4-[(1R)-1-iodo-2,2-dimethylpropyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate (PubChem CID 101200022) has the molecular formula C13H20INO2 and a molecular weight of 349.21 g/mol. Its IUPAC name is methyl 4-[(1R)-1-iodo-2,2-dimethylpropyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate.
| Compound Name | methyl 4-[(1R)-1-iodo-2,2-dimethylpropyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 101200022 |
| Molecular Formula | C13H20INO2 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | methyl 4-[(1R)-1-iodo-2,2-dimethylpropyl]-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c(C)c([C@H](I)C(C)(C)C)c1C |
| InChI | InChI=1S/C13H20INO2/c1-7-9(11(14)13(3,4)5)8(2)15-10(7)12(16)17-6/h11,15H,1-6H3/t11-/m0/s1 |
| InChIKey | UHKXCAIJPRRXPS-NSHDSACASA-N |
| XLogP | 3.94 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|