C21H39F2O6P — CID 101200473
[(2R)-1,1-difluoro-3-phosphonooxypropan-2-yl] (Z)-octadec-9-enoate (PubChem CID 101200473) has the molecular formula C21H39F2O6P and a molecular weight of 456.51 g/mol. Its IUPAC name is [(2R)-1,1-difluoro-3-phosphonooxypropan-2-yl] (Z)-octadec-9-enoate.
| Compound Name | [(2R)-1,1-difluoro-3-phosphonooxypropan-2-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 101200473 |
| Molecular Formula | C21H39F2O6P |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(2R)-1,1-difluoro-3-phosphonooxypropan-2-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O[C@H](COP(=O)(O)O)C(F)F |
| InChI | InChI=1S/C21H39F2O6P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)29-19(21(22)23)18-28-30(25,26)27/h9-10,19,21H,2-8,11-18H2,1H3,(H2,25,26,27)/b10-9-/t19-/m1/s1 |
| InChIKey | FJPWQJDOXYSIEW-ZBTAVZRMSA-N |
| XLogP | 6.31 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|