C22H22O — CID 101200919
4,4-bis[(E)-3-phenylprop-2-enyl]-3,5-dihydro-2H-furan-1-ium-5-ide (PubChem CID 101200919) has the molecular formula C22H22O and a molecular weight of 302.42 g/mol. Its IUPAC name is 4,4-bis[(E)-3-phenylprop-2-enyl]-3,5-dihydro-2H-furan-1-ium-5-ide.
| Compound Name | 4,4-bis[(E)-3-phenylprop-2-enyl]-3,5-dihydro-2H-furan-1-ium-5-ide |
|---|---|
| PubChem CID | 101200919 |
| Molecular Formula | C22H22O |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4,4-bis[(E)-3-phenylprop-2-enyl]-3,5-dihydro-2H-furan-1-ium-5-ide |
| SMILES | [C-]1=[O+]CCC1(C/C=C/c1ccccc1)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H22O/c1-3-9-20(10-4-1)13-7-15-22(17-18-23-19-22)16-8-14-21-11-5-2-6-12-21/h1-14H,15-18H2/b13-7+,14-8+ |
| InChIKey | ZVSIJPAGOLAEFH-FNCQTZNRSA-N |
| XLogP | 5.23 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|