C21H22N2O3 — CID 101201943
1-[(3S,4R)-3-(4-methylphenyl)-2-phenyl-1,2-oxazolidine-4-carbonyl]pyrrolidin-2-one (PubChem CID 101201943) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[(3S,4R)-3-(4-methylphenyl)-2-phenyl-1,2-oxazolidine-4-carbonyl]pyrrolidin-2-one.
| Compound Name | 1-[(3S,4R)-3-(4-methylphenyl)-2-phenyl-1,2-oxazolidine-4-carbonyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 101201943 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[(3S,4R)-3-(4-methylphenyl)-2-phenyl-1,2-oxazolidine-4-carbonyl]pyrrolidin-2-one |
| SMILES | Cc1ccc([C@@H]2[C@@H](C(=O)N3CCCC3=O)CON2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H22N2O3/c1-15-9-11-16(12-10-15)20-18(21(25)22-13-5-8-19(22)24)14-26-23(20)17-6-3-2-4-7-17/h2-4,6-7,9-12,18,20H,5,8,13-14H2,1H3/t18-,20+/m0/s1 |
| InChIKey | KTONAGCZGSWASH-AZUAARDMSA-N |
| XLogP | 3.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|