C21H46O2Si — CID 101202761
(6R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-13-methyltetradecan-6-ol (PubChem CID 101202761) has the molecular formula C21H46O2Si and a molecular weight of 358.68 g/mol. Its IUPAC name is (6R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-13-methyltetradecan-6-ol.
| Compound Name | (6R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-13-methyltetradecan-6-ol |
|---|---|
| PubChem CID | 101202761 |
| Molecular Formula | C21H46O2Si |
| Molecular Weight | 358.68 g/mol |
| Exact Mass | 358.33 |
| IUPAC Name | (6R,12R)-12-[tert-butyl(dimethyl)silyl]oxy-13-methyltetradecan-6-ol |
| SMILES | CCCCC[C@@H](O)CCCCC[C@@H](O[Si](C)(C)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C21H46O2Si/c1-9-10-12-15-19(22)16-13-11-14-17-20(18(2)3)23-24(7,8)21(4,5)6/h18-20,22H,9-17H2,1-8H3/t19-,20-/m1/s1 |
| InChIKey | QMKOEQCUIXFEKQ-WOJBJXKFSA-N |
| XLogP | 6.92 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.68 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|