C14H32O2Si — CID 154722508
(2S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-2-ol (PubChem CID 154722508) has the molecular formula C14H32O2Si and a molecular weight of 260.49 g/mol. Its IUPAC name is (2S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-2-ol.
| Compound Name | (2S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-2-ol |
|---|---|
| PubChem CID | 154722508 |
| Molecular Formula | C14H32O2Si |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | (2S,4S,6R)-6-[tert-butyl(dimethyl)silyl]oxy-4-methylheptan-2-ol |
| SMILES | C[C@@H](C[C@H](C)O)C[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H32O2Si/c1-11(9-12(2)15)10-13(3)16-17(7,8)14(4,5)6/h11-13,15H,9-10H2,1-8H3/t11-,12-,13+/m0/s1 |
| InChIKey | VAYMAMZYDGTMJO-RWMBFGLXSA-N |
| XLogP | 4.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|