C15H34O3Si — CID 11437755
(2S,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylheptane-1,5-diol (PubChem CID 11437755) has the molecular formula C15H34O3Si and a molecular weight of 290.52 g/mol. Its IUPAC name is (2S,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylheptane-1,5-diol.
| Compound Name | (2S,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylheptane-1,5-diol |
|---|---|
| PubChem CID | 11437755 |
| Molecular Formula | C15H34O3Si |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | (2S,3S,4R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethylheptane-1,5-diol |
| SMILES | CC[C@H](O)[C@@H](C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C15H34O3Si/c1-9-13(17)12(3)14(11(2)10-16)18-19(7,8)15(4,5)6/h11-14,16-17H,9-10H2,1-8H3/t11-,12+,13-,14-/m0/s1 |
| InChIKey | ZUPBINNKOUWCPX-CRWXNKLISA-N |
| XLogP | 3.41 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|