C18H40O3Si — CID 24776624
(4S,6S,8R)-10-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8-methyldecan-4-ol (PubChem CID 24776624) has the molecular formula C18H40O3Si and a molecular weight of 332.60 g/mol. Its IUPAC name is (4S,6S,8R)-10-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8-methyldecan-4-ol.
| Compound Name | (4S,6S,8R)-10-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8-methyldecan-4-ol |
|---|---|
| PubChem CID | 24776624 |
| Molecular Formula | C18H40O3Si |
| Molecular Weight | 332.60 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | (4S,6S,8R)-10-[tert-butyl(dimethyl)silyl]oxy-6-methoxy-8-methyldecan-4-ol |
| SMILES | CCC[C@H](O)C[C@H](C[C@H](C)CCO[Si](C)(C)C(C)(C)C)OC |
| InChI | InChI=1S/C18H40O3Si/c1-9-10-16(19)14-17(20-6)13-15(2)11-12-21-22(7,8)18(3,4)5/h15-17,19H,9-14H2,1-8H3/t15-,16+,17+/m1/s1 |
| InChIKey | ITYADYJESYFNPA-IKGGRYGDSA-N |
| XLogP | 4.99 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|