C17H38O3Si — CID 134838175
(4R,6R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnonane-3,7-diol (PubChem CID 134838175) has the molecular formula C17H38O3Si and a molecular weight of 318.57 g/mol. Its IUPAC name is (4R,6R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnonane-3,7-diol.
| Compound Name | (4R,6R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnonane-3,7-diol |
|---|---|
| PubChem CID | 134838175 |
| Molecular Formula | C17H38O3Si |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | (4R,6R,7R)-5-[tert-butyl(dimethyl)silyl]oxy-4,6-dimethylnonane-3,7-diol |
| SMILES | CCC(O)[C@@H](C)C(O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O)CC |
| InChI | InChI=1S/C17H38O3Si/c1-10-14(18)12(3)16(13(4)15(19)11-2)20-21(8,9)17(5,6)7/h12-16,18-19H,10-11H2,1-9H3/t12-,13-,14-,15?,16?/m1/s1 |
| InChIKey | FPVHOUXSTCAWAI-AUVVZJRPSA-N |
| XLogP | 4.19 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|