C16H36O3Si — CID 12020419
(2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyloctane-3,5-diol (PubChem CID 12020419) has the molecular formula C16H36O3Si and a molecular weight of 304.55 g/mol. Its IUPAC name is (2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyloctane-3,5-diol.
| Compound Name | (2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyloctane-3,5-diol |
|---|---|
| PubChem CID | 12020419 |
| Molecular Formula | C16H36O3Si |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (2S,3S,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4,7-dimethyloctane-3,5-diol |
| SMILES | CC(C)C[C@H](O)[C@@H](C)[C@H](O)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O3Si/c1-11(2)10-14(17)12(3)15(18)13(4)19-20(8,9)16(5,6)7/h11-15,17-18H,10H2,1-9H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | QLOGIPNIZCWSSC-QPSCCSFWSA-N |
| XLogP | 3.80 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|