C18H37FO3Si — CID 143247526
1-(2,2-dibutyl-5-ethyl-1,3,2-dioxasilinan-4-yl)-2-(fluoromethyl)butan-1-ol (PubChem CID 143247526) has the molecular formula C18H37FO3Si and a molecular weight of 348.58 g/mol. Its IUPAC name is 1-(2,2-dibutyl-5-ethyl-1,3,2-dioxasilinan-4-yl)-2-(fluoromethyl)butan-1-ol.
| Compound Name | 1-(2,2-dibutyl-5-ethyl-1,3,2-dioxasilinan-4-yl)-2-(fluoromethyl)butan-1-ol |
|---|---|
| PubChem CID | 143247526 |
| Molecular Formula | C18H37FO3Si |
| Molecular Weight | 348.58 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | 1-(2,2-dibutyl-5-ethyl-1,3,2-dioxasilinan-4-yl)-2-(fluoromethyl)butan-1-ol |
| SMILES | CCCC[Si]1(CCCC)OCC(CC)C(C(O)C(CC)CF)O1 |
| InChI | InChI=1S/C18H37FO3Si/c1-5-9-11-23(12-10-6-2)21-14-16(8-4)18(22-23)17(20)15(7-3)13-19/h15-18,20H,5-14H2,1-4H3 |
| InChIKey | HCNZYEFUXDIEQW-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.58 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|