C16H36O3Si — CID 102278790
(3S,4S,5S,6R)-5-ethyl-6-triethylsilyloxyoctane-3,4-diol (PubChem CID 102278790) has the molecular formula C16H36O3Si and a molecular weight of 304.55 g/mol. Its IUPAC name is (3S,4S,5S,6R)-5-ethyl-6-triethylsilyloxyoctane-3,4-diol.
| Compound Name | (3S,4S,5S,6R)-5-ethyl-6-triethylsilyloxyoctane-3,4-diol |
|---|---|
| PubChem CID | 102278790 |
| Molecular Formula | C16H36O3Si |
| Molecular Weight | 304.55 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (3S,4S,5S,6R)-5-ethyl-6-triethylsilyloxyoctane-3,4-diol |
| SMILES | CC[C@@H]([C@H](O)[C@@H](O)CC)[C@@H](CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H36O3Si/c1-7-13(16(18)14(17)8-2)15(9-3)19-20(10-4,11-5)12-6/h13-18H,7-12H2,1-6H3/t13-,14+,15-,16+/m1/s1 |
| InChIKey | HYVBUGCXQBJKSS-QXSJWSMHSA-N |
| XLogP | 3.94 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.55 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|