C19H44O5Si2 — CID 14061530
(2R,3R)-3-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]butane-1,2,4-triol (PubChem CID 14061530) has the molecular formula C19H44O5Si2 and a molecular weight of 408.73 g/mol. Its IUPAC name is (2R,3R)-3-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]butane-1,2,4-triol.
| Compound Name | (2R,3R)-3-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]butane-1,2,4-triol |
|---|---|
| PubChem CID | 14061530 |
| Molecular Formula | C19H44O5Si2 |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | (2R,3R)-3-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]butane-1,2,4-triol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)[C@@H](O)CO |
| InChI | InChI=1S/C19H44O5Si2/c1-18(2,3)25(7,8)23-12-11-17(15(13-20)16(22)14-21)24-26(9,10)19(4,5)6/h15-17,20-22H,11-14H2,1-10H3/t15-,16+,17+/m1/s1 |
| InChIKey | BITHHDIJYQFTRD-IKGGRYGDSA-N |
| XLogP | 3.75 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|