C27H58O4Si3 — CID 102143529
(2R,3R,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-4-methyl-6-trimethylsilylhex-5-yne-1,3-diol (PubChem CID 102143529) has the molecular formula C27H58O4Si3 and a molecular weight of 531.02 g/mol. Its IUPAC name is (2R,3R,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-4-methyl-6-trimethylsilylhex-5-yne-1,3-diol.
| Compound Name | (2R,3R,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-4-methyl-6-trimethylsilylhex-5-yne-1,3-diol |
|---|---|
| PubChem CID | 102143529 |
| Molecular Formula | C27H58O4Si3 |
| Molecular Weight | 531.02 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | (2R,3R,4S)-2-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-tri(propan-2-yl)silyloxyethyl]-4-methyl-6-trimethylsilylhex-5-yne-1,3-diol |
| SMILES | CC(C)[Si](OC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CO)[C@H](O)[C@@H](C)C#C[Si](C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H58O4Si3/c1-20(2)34(21(3)4,22(5)6)30-19-25(31-33(14,15)27(8,9)10)24(18-28)26(29)23(7)16-17-32(11,12)13/h20-26,28-29H,18-19H2,1-15H3/t23-,24-,25-,26+/m0/s1 |
| InChIKey | UWZMVNCNJRUJLR-ASDGIDEWSA-N |
| XLogP | 7.06 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.02 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|