C17H36O4Si2 — CID 134878533
(2S,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yne-1,3,5-triol (PubChem CID 134878533) has the molecular formula C17H36O4Si2 and a molecular weight of 360.64 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yne-1,3,5-triol.
| Compound Name | (2S,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yne-1,3,5-triol |
|---|---|
| PubChem CID | 134878533 |
| Molecular Formula | C17H36O4Si2 |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (2S,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methyl-7-trimethylsilylhept-6-yne-1,3,5-triol |
| SMILES | C[C@H]([C@@H](O)[C@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C17H36O4Si2/c1-13(14(19)10-11-22(5,6)7)16(20)15(12-18)21-23(8,9)17(2,3)4/h13-16,18-20H,12H2,1-9H3/t13-,14+,15-,16+/m0/s1 |
| InChIKey | GDSMIEAIBHLEDM-XUWVNRHRSA-N |
| XLogP | 2.61 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|