C28H52O4Si2 — CID 102303639
[(2S,3R,4S,5R,6R)-3,6-diethynyl-4,5-bis[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol (PubChem CID 102303639) has the molecular formula C28H52O4Si2 and a molecular weight of 508.89 g/mol. Its IUPAC name is [(2S,3R,4S,5R,6R)-3,6-diethynyl-4,5-bis[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol.
| Compound Name | [(2S,3R,4S,5R,6R)-3,6-diethynyl-4,5-bis[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 102303639 |
| Molecular Formula | C28H52O4Si2 |
| Molecular Weight | 508.89 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | [(2S,3R,4S,5R,6R)-3,6-diethynyl-4,5-bis[tri(propan-2-yl)silyloxy]oxan-2-yl]methanol |
| SMILES | C#C[C@H]1[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C#C)O[C@@H]1CO |
| InChI | InChI=1S/C28H52O4Si2/c1-15-24-26(17-29)30-25(16-2)28(32-34(21(9)10,22(11)12)23(13)14)27(24)31-33(18(3)4,19(5)6)20(7)8/h1-2,18-29H,17H2,3-14H3/t24-,25-,26-,27+,28-/m1/s1 |
| InChIKey | ZITMTIGBAZEMJJ-VNFNVIIVSA-N |
| XLogP | 6.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.89 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|