C35H67BrO5Si3 — CID 100960244
(2S,3R,4S,5S,6S)-2-(2-bromoethynyl)-5-[2-[dimethyl-[2-methyl-4-tri(propan-2-yl)silyloxybutan-2-yl]silyl]ethynyl]-6-(hydroxymethyl)-3-tri(propan-2-yl)silyloxyoxan-4-ol (PubChem CID 100960244) has the molecular formula C35H67BrO5Si3 and a molecular weight of 732.08 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-(2-bromoethynyl)-5-[2-[dimethyl-[2-methyl-4-tri(propan-2-yl)silyloxybutan-2-yl]silyl]ethynyl]-6-(hydroxymethyl)-3-tri(propan-2-yl)silyloxyoxan-4-ol.
| Compound Name | (2S,3R,4S,5S,6S)-2-(2-bromoethynyl)-5-[2-[dimethyl-[2-methyl-4-tri(propan-2-yl)silyloxybutan-2-yl]silyl]ethynyl]-6-(hydroxymethyl)-3-tri(propan-2-yl)silyloxyoxan-4-ol |
|---|---|
| PubChem CID | 100960244 |
| Molecular Formula | C35H67BrO5Si3 |
| Molecular Weight | 732.08 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-(2-bromoethynyl)-5-[2-[dimethyl-[2-methyl-4-tri(propan-2-yl)silyloxybutan-2-yl]silyl]ethynyl]-6-(hydroxymethyl)-3-tri(propan-2-yl)silyloxyoxan-4-ol |
| SMILES | CC(C)[Si](OCCC(C)(C)[Si](C)(C)C#CC1[C@@H](CO)O[C@@H](C#CBr)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H]1O)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H67BrO5Si3/c1-24(2)43(25(3)4,26(5)6)39-21-19-35(13,14)42(15,16)22-18-30-32(23-37)40-31(17-20-36)34(33(30)38)41-44(27(7)8,28(9)10)29(11)12/h24-34,37-38H,19,21,23H2,1-16H3/t30?,31-,32+,33-,34-/m0/s1 |
| InChIKey | UYQFDINETWLNOZ-RFNXDDMISA-N |
| XLogP | 9.25 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.08 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|