C16H28O4Si2 — CID 101196528
(2S,3S,4S,5S,6S)-6-(hydroxymethyl)-2,5-bis(2-trimethylsilylethynyl)oxane-3,4-diol (PubChem CID 101196528) has the molecular formula C16H28O4Si2 and a molecular weight of 340.57 g/mol. Its IUPAC name is (2S,3S,4S,5S,6S)-6-(hydroxymethyl)-2,5-bis(2-trimethylsilylethynyl)oxane-3,4-diol.
| Compound Name | (2S,3S,4S,5S,6S)-6-(hydroxymethyl)-2,5-bis(2-trimethylsilylethynyl)oxane-3,4-diol |
|---|---|
| PubChem CID | 101196528 |
| Molecular Formula | C16H28O4Si2 |
| Molecular Weight | 340.57 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2S,3S,4S,5S,6S)-6-(hydroxymethyl)-2,5-bis(2-trimethylsilylethynyl)oxane-3,4-diol |
| SMILES | C[Si](C)(C)C#C[C@H]1[C@H](O)[C@H](O)[C@H](C#C[Si](C)(C)C)O[C@@H]1CO |
| InChI | InChI=1S/C16H28O4Si2/c1-21(2,3)9-7-12-14(11-17)20-13(16(19)15(12)18)8-10-22(4,5)6/h12-19H,11H2,1-6H3/t12-,13+,14-,15+,16-/m1/s1 |
| InChIKey | MVBFCFSNUQAHCH-DGADGQDISA-N |
| XLogP | 0.85 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.57 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|