C20H40O4Si2 — CID 134938289
(2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-trimethylsilylethynyl)-1,3-dioxan-4-yl]ethanol (PubChem CID 134938289) has the molecular formula C20H40O4Si2 and a molecular weight of 400.71 g/mol. Its IUPAC name is (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-trimethylsilylethynyl)-1,3-dioxan-4-yl]ethanol.
| Compound Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-trimethylsilylethynyl)-1,3-dioxan-4-yl]ethanol |
|---|---|
| PubChem CID | 134938289 |
| Molecular Formula | C20H40O4Si2 |
| Molecular Weight | 400.71 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | (2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R,5S,6S)-2,2,5-trimethyl-6-(2-trimethylsilylethynyl)-1,3-dioxan-4-yl]ethanol |
| SMILES | C[C@@H]1[C@H]([C@H](CO)O[Si](C)(C)C(C)(C)C)OC(C)(C)O[C@@H]1C#C[Si](C)(C)C |
| InChI | InChI=1S/C20H40O4Si2/c1-15-16(12-13-25(7,8)9)22-20(5,6)23-18(15)17(14-21)24-26(10,11)19(2,3)4/h15-18,21H,14H2,1-11H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | BANVIRMCUYRATJ-XWTMOSNGSA-N |
| XLogP | 4.41 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.71 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|