C23H48O5Si3 — CID 135013738
2-(hydroxymethyl)-3,5-bis(triethylsilyloxy)-6-(2-trimethylsilylethynyl)oxan-4-ol (PubChem CID 135013738) has the molecular formula C23H48O5Si3 and a molecular weight of 488.89 g/mol. Its IUPAC name is 2-(hydroxymethyl)-3,5-bis(triethylsilyloxy)-6-(2-trimethylsilylethynyl)oxan-4-ol.
| Compound Name | 2-(hydroxymethyl)-3,5-bis(triethylsilyloxy)-6-(2-trimethylsilylethynyl)oxan-4-ol |
|---|---|
| PubChem CID | 135013738 |
| Molecular Formula | C23H48O5Si3 |
| Molecular Weight | 488.89 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 2-(hydroxymethyl)-3,5-bis(triethylsilyloxy)-6-(2-trimethylsilylethynyl)oxan-4-ol |
| SMILES | CC[Si](CC)(CC)OC1C(C#C[Si](C)(C)C)OC(CO)C(O[Si](CC)(CC)CC)C1O |
| InChI | InChI=1S/C23H48O5Si3/c1-10-30(11-2,12-3)27-22-19(16-17-29(7,8)9)26-20(18-24)23(21(22)25)28-31(13-4,14-5)15-6/h19-25H,10-15,18H2,1-9H3 |
| InChIKey | UGPFPOQILXSUMV-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.89 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|