C22H44O4Si2 — CID 135028759
(2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]pent-3-yn-2-ol (PubChem CID 135028759) has the molecular formula C22H44O4Si2 and a molecular weight of 428.76 g/mol. Its IUPAC name is (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]pent-3-yn-2-ol.
| Compound Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]pent-3-yn-2-ol |
|---|---|
| PubChem CID | 135028759 |
| Molecular Formula | C22H44O4Si2 |
| Molecular Weight | 428.76 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | (2S)-5-[tert-butyl(dimethyl)silyl]oxy-1-[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]pent-3-yn-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC#C[C@@H](O)C[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H44O4Si2/c1-21(2,3)27(7,8)25-16-11-13-18(23)17-20-19(14-12-15-24-20)26-28(9,10)22(4,5)6/h18-20,23H,12,14-17H2,1-10H3/t18-,19+,20-/m1/s1 |
| InChIKey | JTAIYIFLULUPSJ-HSALFYBXSA-N |
| XLogP | 5.33 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.76 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|