C15H32O3Si — CID 54175371
3-[(2R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propan-1-ol (PubChem CID 54175371) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is 3-[(2R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propan-1-ol.
| Compound Name | 3-[(2R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 54175371 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 3-[(2R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCC[C@H](CCCO)O1 |
| InChI | InChI=1S/C15H32O3Si/c1-15(2,3)19(4,5)17-12-14-9-6-8-13(18-14)10-7-11-16/h13-14,16H,6-12H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | OXYGSBGGABWFMS-ZIAGYGMSSA-N |
| XLogP | 3.72 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|