C15H34O3Si — CID 54576109
(2R,4R)-4-[tert-butyl(dimethyl)silyl]oxynonane-1,2-diol (PubChem CID 54576109) has the molecular formula C15H34O3Si and a molecular weight of 290.52 g/mol. Its IUPAC name is (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxynonane-1,2-diol.
| Compound Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxynonane-1,2-diol |
|---|---|
| PubChem CID | 54576109 |
| Molecular Formula | C15H34O3Si |
| Molecular Weight | 290.52 g/mol |
| Exact Mass | 290.23 |
| IUPAC Name | (2R,4R)-4-[tert-butyl(dimethyl)silyl]oxynonane-1,2-diol |
| SMILES | CCCCC[C@H](C[C@@H](O)CO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H34O3Si/c1-7-8-9-10-14(11-13(17)12-16)18-19(5,6)15(2,3)4/h13-14,16-17H,7-12H2,1-6H3/t13-,14-/m1/s1 |
| InChIKey | BLVOLRQZPNORPY-ZIAGYGMSSA-N |
| XLogP | 3.70 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|