C20H40O3Si2 — CID 139247738
tert-butyl-[(2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-2-methyloxan-4-yl]oxy-dimethylsilane (PubChem CID 139247738) has the molecular formula C20H40O3Si2 and a molecular weight of 384.71 g/mol. Its IUPAC name is tert-butyl-[(2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-2-methyloxan-4-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-2-methyloxan-4-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 139247738 |
| Molecular Formula | C20H40O3Si2 |
| Molecular Weight | 384.71 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | tert-butyl-[(2R,3R,4R,6R)-3-[tert-butyl(dimethyl)silyl]oxy-6-ethynyl-2-methyloxan-4-yl]oxy-dimethylsilane |
| SMILES | C#C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)O1 |
| InChI | InChI=1S/C20H40O3Si2/c1-13-16-14-17(22-24(9,10)19(3,4)5)18(15(2)21-16)23-25(11,12)20(6,7)8/h1,15-18H,14H2,2-12H3/t15-,16+,17-,18-/m1/s1 |
| InChIKey | POFISIXPZIFGNP-XMTFNYHQSA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|