C18H42O4Si3 — CID 91758715
[(2R,3S,4R)-3,4-bis[[ethyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-ethyl-dimethylsilane (PubChem CID 91758715) has the molecular formula C18H42O4Si3 and a molecular weight of 406.79 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4-bis[[ethyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-ethyl-dimethylsilane.
| Compound Name | [(2R,3S,4R)-3,4-bis[[ethyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-ethyl-dimethylsilane |
|---|---|
| PubChem CID | 91758715 |
| Molecular Formula | C18H42O4Si3 |
| Molecular Weight | 406.79 g/mol |
| Exact Mass | 406.24 |
| IUPAC Name | [(2R,3S,4R)-3,4-bis[[ethyl(dimethyl)silyl]oxy]oxan-2-yl]methoxy-ethyl-dimethylsilane |
| SMILES | CC[Si](C)(C)OC[C@H]1OCC[C@@H](O[Si](C)(C)CC)[C@H]1O[Si](C)(C)CC |
| InChI | InChI=1S/C18H42O4Si3/c1-10-23(4,5)20-15-17-18(22-25(8,9)12-3)16(13-14-19-17)21-24(6,7)11-2/h16-18H,10-15H2,1-9H3/t16-,17-,18-/m1/s1 |
| InChIKey | RYWRFOHHSNDDIO-KZNAEPCWSA-N |
| XLogP | 5.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.79 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|