C18H44O5Si4 — CID 91750445
trimethyl-[[(2R,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]silane (PubChem CID 91750445) has the molecular formula C18H44O5Si4 and a molecular weight of 452.89 g/mol. Its IUPAC name is trimethyl-[[(2R,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]silane.
| Compound Name | trimethyl-[[(2R,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]silane |
|---|---|
| PubChem CID | 91750445 |
| Molecular Formula | C18H44O5Si4 |
| Molecular Weight | 452.89 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | trimethyl-[[(2R,3R,4S,5R)-3,4,5-tris(trimethylsilyloxy)oxan-2-yl]methoxy]silane |
| SMILES | C[Si](C)(C)OC[C@H]1OC[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C18H44O5Si4/c1-24(2,3)20-14-15-17(22-26(7,8)9)18(23-27(10,11)12)16(13-19-15)21-25(4,5)6/h15-18H,13-14H2,1-12H3/t15-,16-,17-,18+/m1/s1 |
| InChIKey | BKZSHWBRUJTUIK-TVFCKZIOSA-N |
| XLogP | 4.90 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.89 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|