C25H54O3Si3 — CID 11420371
[(2S,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-yn-3-yl]oxy-triethylsilane (PubChem CID 11420371) has the molecular formula C25H54O3Si3 and a molecular weight of 486.96 g/mol. Its IUPAC name is [(2S,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-yn-3-yl]oxy-triethylsilane.
| Compound Name | [(2S,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-yn-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11420371 |
| Molecular Formula | C25H54O3Si3 |
| Molecular Weight | 486.96 g/mol |
| Exact Mass | 486.34 |
| IUPAC Name | [(2S,3R,5S)-2,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-yn-3-yl]oxy-triethylsilane |
| SMILES | C#C[C@H](C[C@@H](O[Si](CC)(CC)CC)[C@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H54O3Si3/c1-16-22(27-30(14,15)25(9,10)11)20-23(28-31(17-2,18-3)19-4)21(5)26-29(12,13)24(6,7)8/h1,21-23H,17-20H2,2-15H3/t21-,22+,23+/m0/s1 |
| InChIKey | YWUKYLDPAHBMDO-YTFSRNRJSA-N |
| XLogP | 8.20 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.96 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|