C22H54O4Si4 — CID 91758725
ethyl-dimethyl-[(2R,3R,4R,5R)-2,4,5-tris[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxysilane (PubChem CID 91758725) has the molecular formula C22H54O4Si4 and a molecular weight of 495.01 g/mol. Its IUPAC name is ethyl-dimethyl-[(2R,3R,4R,5R)-2,4,5-tris[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxysilane.
| Compound Name | ethyl-dimethyl-[(2R,3R,4R,5R)-2,4,5-tris[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxysilane |
|---|---|
| PubChem CID | 91758725 |
| Molecular Formula | C22H54O4Si4 |
| Molecular Weight | 495.01 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | ethyl-dimethyl-[(2R,3R,4R,5R)-2,4,5-tris[[ethyl(dimethyl)silyl]oxy]hexan-3-yl]oxysilane |
| SMILES | CC[Si](C)(C)O[C@@H]([C@H](O[Si](C)(C)CC)[C@@H](C)O[Si](C)(C)CC)[C@@H](C)O[Si](C)(C)CC |
| InChI | InChI=1S/C22H54O4Si4/c1-15-27(7,8)23-19(5)21(25-29(11,12)17-3)22(26-30(13,14)18-4)20(6)24-28(9,10)16-2/h19-22H,15-18H2,1-14H3/t19-,20-,21-,22-/m1/s1 |
| InChIKey | KAXAVDRDRSQJKG-GXRSIYKFSA-N |
| XLogP | 7.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.01 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|