C20H52O5Si5 — CID 91746473
trimethyl-[(2S,4S)-1,2,4,5-tetrakis(trimethylsilyloxy)pentan-3-yl]oxysilane (PubChem CID 91746473) has the molecular formula C20H52O5Si5 and a molecular weight of 513.06 g/mol. Its IUPAC name is trimethyl-[(2S,4S)-1,2,4,5-tetrakis(trimethylsilyloxy)pentan-3-yl]oxysilane.
| Compound Name | trimethyl-[(2S,4S)-1,2,4,5-tetrakis(trimethylsilyloxy)pentan-3-yl]oxysilane |
|---|---|
| PubChem CID | 91746473 |
| Molecular Formula | C20H52O5Si5 |
| Molecular Weight | 513.06 g/mol |
| Exact Mass | 512.27 |
| IUPAC Name | trimethyl-[(2S,4S)-1,2,4,5-tetrakis(trimethylsilyloxy)pentan-3-yl]oxysilane |
| SMILES | C[Si](C)(C)OC[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)[C@H](CO[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C20H52O5Si5/c1-26(2,3)21-16-18(23-28(7,8)9)20(25-30(13,14)15)19(24-29(10,11)12)17-22-27(4,5)6/h18-20H,16-17H2,1-15H3/t18-,19-/m0/s1 |
| InChIKey | SUZLPERYXSOGNY-OALUTQOASA-N |
| XLogP | 6.35 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.06 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|