C22H48O3Si3 — CID 11305351
(3S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-1-trimethylsilylhept-1-yn-3-ol (PubChem CID 11305351) has the molecular formula C22H48O3Si3 and a molecular weight of 444.88 g/mol. Its IUPAC name is (3S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-1-trimethylsilylhept-1-yn-3-ol.
| Compound Name | (3S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-1-trimethylsilylhept-1-yn-3-ol |
|---|---|
| PubChem CID | 11305351 |
| Molecular Formula | C22H48O3Si3 |
| Molecular Weight | 444.88 g/mol |
| Exact Mass | 444.29 |
| IUPAC Name | (3S,5R,6S)-6-[tert-butyl(dimethyl)silyl]oxy-5-triethylsilyloxy-1-trimethylsilylhept-1-yn-3-ol |
| SMILES | CC[Si](CC)(CC)O[C@H](C[C@H](O)C#C[Si](C)(C)C)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H48O3Si3/c1-13-28(14-2,15-3)25-21(18-20(23)16-17-26(8,9)10)19(4)24-27(11,12)22(5,6)7/h19-21,23H,13-15,18H2,1-12H3/t19-,20+,21+/m0/s1 |
| InChIKey | KZBAVXXSQHRQFH-PWRODBHTSA-N |
| XLogP | 6.42 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.88 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|