C22H46O3Si2 — CID 135022963
(2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-tri(propan-2-yl)silyloxyhex-4-yn-2-ol (PubChem CID 135022963) has the molecular formula C22H46O3Si2 and a molecular weight of 414.78 g/mol. Its IUPAC name is (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-tri(propan-2-yl)silyloxyhex-4-yn-2-ol.
| Compound Name | (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-tri(propan-2-yl)silyloxyhex-4-yn-2-ol |
|---|---|
| PubChem CID | 135022963 |
| Molecular Formula | C22H46O3Si2 |
| Molecular Weight | 414.78 g/mol |
| Exact Mass | 414.30 |
| IUPAC Name | (2R,3S)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-1-tri(propan-2-yl)silyloxyhex-4-yn-2-ol |
| SMILES | CC#C[C@@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C22H46O3Si2/c1-13-14-20(15-24-26(11,12)22(8,9)10)21(23)16-25-27(17(2)3,18(4)5)19(6)7/h17-21,23H,15-16H2,1-12H3/t20-,21-/m0/s1 |
| InChIKey | XKQYGNICEGKCNQ-SFTDATJTSA-N |
| XLogP | 6.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.78 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|