C16H32O2Si — CID 135017386
(2S,3S)-2-methyl-3-tri(propan-2-yl)silyloxyhex-4-yn-1-ol (PubChem CID 135017386) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is (2S,3S)-2-methyl-3-tri(propan-2-yl)silyloxyhex-4-yn-1-ol.
| Compound Name | (2S,3S)-2-methyl-3-tri(propan-2-yl)silyloxyhex-4-yn-1-ol |
|---|---|
| PubChem CID | 135017386 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | (2S,3S)-2-methyl-3-tri(propan-2-yl)silyloxyhex-4-yn-1-ol |
| SMILES | CC#C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C16H32O2Si/c1-9-10-16(15(8)11-17)18-19(12(2)3,13(4)5)14(6)7/h12-17H,11H2,1-8H3/t15-,16+/m0/s1 |
| InChIKey | RJSUEKNNODSQEF-JKSUJKDBSA-N |
| XLogP | 4.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|