C26H54O4Si3 — CID 134931502
CID 134931502 (PubChem CID 134931502) has the molecular formula C26H54O4Si3 and a molecular weight of 514.97 g/mol.
| Compound Name | CID 134931502 |
|---|---|
| PubChem CID | 134931502 |
| Molecular Formula | C26H54O4Si3 |
| Molecular Weight | 514.97 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | — |
| SMILES | CC[Si](CC)OC[C@H](C)[C@@H](O[Si](CC)CC)[C@@H](C)C#C[C@H](O)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O4Si3/c1-13-31(14-2)28-19-23(7)25(30-32(15-3)16-4)21(5)17-18-24(27)22(6)20-29-33(11,12)26(8,9)10/h21-25,27H,13-16,19-20H2,1-12H3/t21-,22-,23-,24-,25-/m0/s1 |
| InChIKey | AZIQUQHUSGXTEX-KEOOTSPTSA-N |
| XLogP | 6.75 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.97 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|