C16H32O3Si — CID 135042085
(2S,3R)-3-[tri(propan-2-yl)silyloxymethyl]hex-4-yne-1,2-diol (PubChem CID 135042085) has the molecular formula C16H32O3Si and a molecular weight of 300.52 g/mol. Its IUPAC name is (2S,3R)-3-[tri(propan-2-yl)silyloxymethyl]hex-4-yne-1,2-diol.
| Compound Name | (2S,3R)-3-[tri(propan-2-yl)silyloxymethyl]hex-4-yne-1,2-diol |
|---|---|
| PubChem CID | 135042085 |
| Molecular Formula | C16H32O3Si |
| Molecular Weight | 300.52 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (2S,3R)-3-[tri(propan-2-yl)silyloxymethyl]hex-4-yne-1,2-diol |
| SMILES | CC#C[C@H](CO[Si](C(C)C)(C(C)C)C(C)C)[C@H](O)CO |
| InChI | InChI=1S/C16H32O3Si/c1-8-9-15(16(18)10-17)11-19-20(12(2)3,13(4)5)14(6)7/h12-18H,10-11H2,1-7H3/t15-,16-/m1/s1 |
| InChIKey | MCOXVJMYUIXJIA-HZPDHXFCSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.52 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|