C21H46O3Si3 — CID 134930779
(3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylhex-1-yn-3-ol (PubChem CID 134930779) has the molecular formula C21H46O3Si3 and a molecular weight of 430.85 g/mol. Its IUPAC name is (3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylhex-1-yn-3-ol.
| Compound Name | (3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylhex-1-yn-3-ol |
|---|---|
| PubChem CID | 134930779 |
| Molecular Formula | C21H46O3Si3 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (3R,4S)-4,6-bis[[tert-butyl(dimethyl)silyl]oxy]-1-trimethylsilylhex-1-yn-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)C#C[Si](C)(C)C |
| InChI | InChI=1S/C21H46O3Si3/c1-20(2,3)26(10,11)23-16-14-19(18(22)15-17-25(7,8)9)24-27(12,13)21(4,5)6/h18-19,22H,14,16H2,1-13H3/t18-,19+/m1/s1 |
| InChIKey | GEZMTOFMJNTQNJ-MOPGFXCFSA-N |
| XLogP | 6.03 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|