C19H34O5Si — CID 134872461
(4S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,9-diethoxynona-1,8-diyne-4,6-diol (PubChem CID 134872461) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is (4S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,9-diethoxynona-1,8-diyne-4,6-diol.
| Compound Name | (4S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,9-diethoxynona-1,8-diyne-4,6-diol |
|---|---|
| PubChem CID | 134872461 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | (4S,6S)-5-[tert-butyl(dimethyl)silyl]oxy-1,9-diethoxynona-1,8-diyne-4,6-diol |
| SMILES | CCOC#CC[C@H](O)C(O[Si](C)(C)C(C)(C)C)[C@@H](O)CC#COCC |
| InChI | InChI=1S/C19H34O5Si/c1-8-22-14-10-12-16(20)18(17(21)13-11-15-23-9-2)24-25(6,7)19(3,4)5/h16-18,20-21H,8-9,12-13H2,1-7H3/t16-,17-/m0/s1 |
| InChIKey | CNIWTRLXZLXLEW-IRXDYDNUSA-N |
| XLogP | 2.87 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|