C23H48O4Si2 — CID 134928395
5-tri(propan-2-yl)silyl-2-tri(propan-2-yl)silylperoxypent-4-yne-1,3-diol (PubChem CID 134928395) has the molecular formula C23H48O4Si2 and a molecular weight of 444.81 g/mol. Its IUPAC name is 5-tri(propan-2-yl)silyl-2-tri(propan-2-yl)silylperoxypent-4-yne-1,3-diol.
| Compound Name | 5-tri(propan-2-yl)silyl-2-tri(propan-2-yl)silylperoxypent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 134928395 |
| Molecular Formula | C23H48O4Si2 |
| Molecular Weight | 444.81 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 5-tri(propan-2-yl)silyl-2-tri(propan-2-yl)silylperoxypent-4-yne-1,3-diol |
| SMILES | CC(C)[Si](C#CC(O)C(CO)OO[Si](C(C)C)(C(C)C)C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H48O4Si2/c1-16(2)28(17(3)4,18(5)6)14-13-22(25)23(15-24)26-27-29(19(7)8,20(9)10)21(11)12/h16-25H,15H2,1-12H3 |
| InChIKey | HQPAARXWWUKXEO-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.81 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|