C20H44O2Si3 — CID 162397169
(2S,3S)-3-triethylsilyl-1-triethylsilyloxy-5-trimethylsilylpent-4-yn-2-ol (PubChem CID 162397169) has the molecular formula C20H44O2Si3 and a molecular weight of 400.83 g/mol. Its IUPAC name is (2S,3S)-3-triethylsilyl-1-triethylsilyloxy-5-trimethylsilylpent-4-yn-2-ol.
| Compound Name | (2S,3S)-3-triethylsilyl-1-triethylsilyloxy-5-trimethylsilylpent-4-yn-2-ol |
|---|---|
| PubChem CID | 162397169 |
| Molecular Formula | C20H44O2Si3 |
| Molecular Weight | 400.83 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | (2S,3S)-3-triethylsilyl-1-triethylsilyloxy-5-trimethylsilylpent-4-yn-2-ol |
| SMILES | CC[Si](CC)(CC)OC[C@H](O)[C@H](C#C[Si](C)(C)C)[Si](CC)(CC)CC |
| InChI | InChI=1S/C20H44O2Si3/c1-10-24(11-2,12-3)20(16-17-23(7,8)9)19(21)18-22-25(13-4,14-5)15-6/h19-21H,10-15,18H2,1-9H3/t19-,20-/m0/s1 |
| InChIKey | HJXHOUYAXDUPJA-PMACEKPBSA-N |
| XLogP | 6.13 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.83 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|